C18H25N3O2 — CID 83946523
5-(3-aminopropyl)-2-ethyl-8-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-6-carboxylic acid (PubChem CID 83946523) has the molecular formula C18H25N3O2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 5-(3-aminopropyl)-2-ethyl-8-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-6-carboxylic acid.
| Compound Name | 5-(3-aminopropyl)-2-ethyl-8-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-6-carboxylic acid |
|---|---|
| PubChem CID | 83946523 |
| Molecular Formula | C18H25N3O2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.19 |
| IUPAC Name | 5-(3-aminopropyl)-2-ethyl-8-methyl-3,4-dihydro-1H-pyrido[4,3-b]indole-6-carboxylic acid |
| SMILES | CCN1CCc2c(c3cc(C)cc(C(=O)O)c3n2CCCN)C1 |
| InChI | InChI=1S/C18H25N3O2/c1-3-20-8-5-16-15(11-20)13-9-12(2)10-14(18(22)23)17(13)21(16)7-4-6-19/h9-10H,3-8,11,19H2,1-2H3,(H,22,23) |
| InChIKey | VCFKFWVCPIZZBQ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 71.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|