C17H22N2O2 — CID 83947396
2,6-dimethyl-3-(2-pyrrolidin-1-ylethyl)-1H-indole-7-carboxylic acid (PubChem CID 83947396) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is 2,6-dimethyl-3-(2-pyrrolidin-1-ylethyl)-1H-indole-7-carboxylic acid.
| Compound Name | 2,6-dimethyl-3-(2-pyrrolidin-1-ylethyl)-1H-indole-7-carboxylic acid |
|---|---|
| PubChem CID | 83947396 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 2,6-dimethyl-3-(2-pyrrolidin-1-ylethyl)-1H-indole-7-carboxylic acid |
| SMILES | Cc1ccc2c(CCN3CCCC3)c(C)[nH]c2c1C(=O)O |
| InChI | InChI=1S/C17H22N2O2/c1-11-5-6-14-13(7-10-19-8-3-4-9-19)12(2)18-16(14)15(11)17(20)21/h5-6,18H,3-4,7-10H2,1-2H3,(H,20,21) |
| InChIKey | GATBRDLPDDLSHK-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|