C17H20ClNO2S — CID 83951103
2-(5-chlorothiophen-2-yl)-3-[4-(diethylamino)phenyl]propanoic acid (PubChem CID 83951103) has the molecular formula C17H20ClNO2S and a molecular weight of 337.87 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)-3-[4-(diethylamino)phenyl]propanoic acid.
| Compound Name | 2-(5-chlorothiophen-2-yl)-3-[4-(diethylamino)phenyl]propanoic acid |
|---|---|
| PubChem CID | 83951103 |
| Molecular Formula | C17H20ClNO2S |
| Molecular Weight | 337.87 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)-3-[4-(diethylamino)phenyl]propanoic acid |
| SMILES | CCN(CC)c1ccc(CC(C(=O)O)c2ccc(Cl)s2)cc1 |
| InChI | InChI=1S/C17H20ClNO2S/c1-3-19(4-2)13-7-5-12(6-8-13)11-14(17(20)21)15-9-10-16(18)22-15/h5-10,14H,3-4,11H2,1-2H3,(H,20,21) |
| InChIKey | MCKQWYYXRXFYJN-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.87 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|