C17H19ClO2S — CID 83954308
3-(4-tert-butylphenyl)-2-(5-chlorothiophen-2-yl)propanoic acid (PubChem CID 83954308) has the molecular formula C17H19ClO2S and a molecular weight of 322.86 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)-2-(5-chlorothiophen-2-yl)propanoic acid.
| Compound Name | 3-(4-tert-butylphenyl)-2-(5-chlorothiophen-2-yl)propanoic acid |
|---|---|
| PubChem CID | 83954308 |
| Molecular Formula | C17H19ClO2S |
| Molecular Weight | 322.86 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 3-(4-tert-butylphenyl)-2-(5-chlorothiophen-2-yl)propanoic acid |
| SMILES | CC(C)(C)c1ccc(CC(C(=O)O)c2ccc(Cl)s2)cc1 |
| InChI | InChI=1S/C17H19ClO2S/c1-17(2,3)12-6-4-11(5-7-12)10-13(16(19)20)14-8-9-15(18)21-14/h4-9,13H,10H2,1-3H3,(H,19,20) |
| InChIKey | GACWPWQAYMQARN-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.86 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |