C15H15ClO3S — CID 83955898
2-(5-chlorothiophen-2-yl)-3-(2-ethoxyphenyl)propanoic acid (PubChem CID 83955898) has the molecular formula C15H15ClO3S and a molecular weight of 310.80 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)-3-(2-ethoxyphenyl)propanoic acid.
| Compound Name | 2-(5-chlorothiophen-2-yl)-3-(2-ethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 83955898 |
| Molecular Formula | C15H15ClO3S |
| Molecular Weight | 310.80 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)-3-(2-ethoxyphenyl)propanoic acid |
| SMILES | CCOc1ccccc1CC(C(=O)O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C15H15ClO3S/c1-2-19-12-6-4-3-5-10(12)9-11(15(17)18)13-7-8-14(16)20-13/h3-8,11H,2,9H2,1H3,(H,17,18) |
| InChIKey | YMCTUUWLSZDJGI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.80 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |