C9H11F3OS — CID 83957671
1,1,1-trifluoro-2-(5-methylthiophen-2-yl)butan-2-ol (PubChem CID 83957671) has the molecular formula C9H11F3OS and a molecular weight of 224.25 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-(5-methylthiophen-2-yl)butan-2-ol.
| Compound Name | 1,1,1-trifluoro-2-(5-methylthiophen-2-yl)butan-2-ol |
|---|---|
| PubChem CID | 83957671 |
| Molecular Formula | C9H11F3OS |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.05 |
| IUPAC Name | 1,1,1-trifluoro-2-(5-methylthiophen-2-yl)butan-2-ol |
| SMILES | CCC(O)(c1ccc(C)s1)C(F)(F)F |
| InChI | InChI=1S/C9H11F3OS/c1-3-8(13,9(10,11)12)7-5-4-6(2)14-7/h4-5,13H,3H2,1-2H3 |
| InChIKey | IRLQYLHGDFWPNE-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |