2,6-dimethyl-2,8-diazaspiro[4.5]decane-10-carboxylic acid

C11H20N2O2 — CID 83960003

IUPAC2,6-dimethyl-2,8-diazaspiro[4.5]decane-10-carboxylic acid
SMILESCC1CNCC(C(=O)O)C12CCN(C)C2
InChIInChI=1S/C11H20N2O2/c1-8-5-12-6-9(10(14)15)11(8)3-4-13(2)7-11/h8-9,12H,3-7H2,1-2H3,(H,14,15)
InChIKeyGGGLABKKEXHWFE-UHFFFAOYSA-N
MW212.29 g/mol
LogP0.25
Rot. Bonds1

About 2,6-dimethyl-2,8-diazaspiro[4.5]decane-10-carboxylic acid

2,6-dimethyl-2,8-diazaspiro[4.5]decane-10-carboxylic acid (PubChem CID 83960003) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is 2,6-dimethyl-2,8-diazaspiro[4.5]decane-10-carboxylic acid.

Molecular Properties

Compound Name2,6-dimethyl-2,8-diazaspiro[4.5]decane-10-carboxylic acid
PubChem CID83960003
Molecular FormulaC11H20N2O2
Molecular Weight212.29 g/mol
Exact Mass212.15
IUPAC Name2,6-dimethyl-2,8-diazaspiro[4.5]decane-10-carboxylic acid
SMILESCC1CNCC(C(=O)O)C12CCN(C)C2
InChIInChI=1S/C11H20N2O2/c1-8-5-12-6-9(10(14)15)11(8)3-4-13(2)7-11/h8-9,12H,3-7H2,1-2H3,(H,14,15)
InChIKeyGGGLABKKEXHWFE-UHFFFAOYSA-N
XLogP0.25
TPSA52.57 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.29
LogP ≤ 50.25
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2,6-dimethyl-2,8-diazaspiro[4.5]decane-10-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,6-dimethyl-2,8-diazaspiro[4.5]decane-10-carboxylic acid?
The IUPAC name of 2,6-dimethyl-2,8-diazaspiro[4.5]decane-10-carboxylic acid (CID 83960003) is 2,6-dimethyl-2,8-diazaspiro[4.5]decane-10-carboxylic acid.
What is the SMILES notation for 2,6-dimethyl-2,8-diazaspiro[4.5]decane-10-carboxylic acid?
The canonical SMILES for 2,6-dimethyl-2,8-diazaspiro[4.5]decane-10-carboxylic acid is CC1CNCC(C(=O)O)C12CCN(C)C2.
What is the InChIKey of 2,6-dimethyl-2,8-diazaspiro[4.5]decane-10-carboxylic acid?
The InChIKey is GGGLABKKEXHWFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20N2O2/c1-8-5-12-6-9(10(14)15)11(8)3-4-13(2)7-11/h8-9,12H,3-7H2,1-2H3,(H,14,15).
What are the key properties of 2,6-dimethyl-2,8-diazaspiro[4.5]decane-10-carboxylic acid?
2,6-dimethyl-2,8-diazaspiro[4.5]decane-10-carboxylic acid has a molecular weight of 212.29 g/mol, XLogP of 0.25, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-2,8-diazaspiro[4.5]decane-10-carboxylic acid is sourced from PubChem (CID 83960003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).