C9H13F3N4O — CID 83965554
2-(methoxymethyl)-6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine (PubChem CID 83965554) has the molecular formula C9H13F3N4O and a molecular weight of 250.22 g/mol. Its IUPAC name is 2-(methoxymethyl)-6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine.
| Compound Name | 2-(methoxymethyl)-6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
|---|---|
| PubChem CID | 83965554 |
| Molecular Formula | C9H13F3N4O |
| Molecular Weight | 250.22 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 2-(methoxymethyl)-6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-8-amine |
| SMILES | COCc1nc2n(n1)CC(C(F)(F)F)CC2N |
| InChI | InChI=1S/C9H13F3N4O/c1-17-4-7-14-8-6(13)2-5(9(10,11)12)3-16(8)15-7/h5-6H,2-4,13H2,1H3 |
| InChIKey | DAXJDHKGUBDEDO-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.22 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |