C15H18ClNO2S — CID 83975930
3-(2-chloro-3,4-dimethoxyphenyl)-2-thiophen-2-ylpropan-1-amine (PubChem CID 83975930) has the molecular formula C15H18ClNO2S and a molecular weight of 311.83 g/mol. Its IUPAC name is 3-(2-chloro-3,4-dimethoxyphenyl)-2-thiophen-2-ylpropan-1-amine.
| Compound Name | 3-(2-chloro-3,4-dimethoxyphenyl)-2-thiophen-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 83975930 |
| Molecular Formula | C15H18ClNO2S |
| Molecular Weight | 311.83 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 3-(2-chloro-3,4-dimethoxyphenyl)-2-thiophen-2-ylpropan-1-amine |
| SMILES | COc1ccc(CC(CN)c2cccs2)c(Cl)c1OC |
| InChI | InChI=1S/C15H18ClNO2S/c1-18-12-6-5-10(14(16)15(12)19-2)8-11(9-17)13-4-3-7-20-13/h3-7,11H,8-9,17H2,1-2H3 |
| InChIKey | KTMCRGVIQPVRJM-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.83 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |