C15H15Cl2NO2S — CID 83977293
2-(benzenesulfonyl)-3-(2,4-dichlorophenyl)propan-1-amine (PubChem CID 83977293) has the molecular formula C15H15Cl2NO2S and a molecular weight of 344.26 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-3-(2,4-dichlorophenyl)propan-1-amine.
| Compound Name | 2-(benzenesulfonyl)-3-(2,4-dichlorophenyl)propan-1-amine |
|---|---|
| PubChem CID | 83977293 |
| Molecular Formula | C15H15Cl2NO2S |
| Molecular Weight | 344.26 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | 2-(benzenesulfonyl)-3-(2,4-dichlorophenyl)propan-1-amine |
| SMILES | NCC(Cc1ccc(Cl)cc1Cl)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H15Cl2NO2S/c16-12-7-6-11(15(17)9-12)8-14(10-18)21(19,20)13-4-2-1-3-5-13/h1-7,9,14H,8,10,18H2 |
| InChIKey | JVBAGSZDHZHRKH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.26 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |