C10H18F3NO — CID 83982971
2-(1-ethylpiperidin-3-yl)-1,1,1-trifluoropropan-2-ol (PubChem CID 83982971) has the molecular formula C10H18F3NO and a molecular weight of 225.25 g/mol. Its IUPAC name is 2-(1-ethylpiperidin-3-yl)-1,1,1-trifluoropropan-2-ol.
| Compound Name | 2-(1-ethylpiperidin-3-yl)-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 83982971 |
| Molecular Formula | C10H18F3NO |
| Molecular Weight | 225.25 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | 2-(1-ethylpiperidin-3-yl)-1,1,1-trifluoropropan-2-ol |
| SMILES | CCN1CCCC(C(C)(O)C(F)(F)F)C1 |
| InChI | InChI=1S/C10H18F3NO/c1-3-14-6-4-5-8(7-14)9(2,15)10(11,12)13/h8,15H,3-7H2,1-2H3 |
| InChIKey | NOXYXDZBKKYJNP-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |