About methyl 6-methyl-1,6-diazatricyclo[6.2.2.02,7]dodecane-3-carboxylate
methyl 6-methyl-1,6-diazatricyclo[6.2.2.02,7]dodecane-3-carboxylate (PubChem CID 83986224) has the molecular formula C13H22N2O2
and a molecular weight of 238.33 g/mol. Its IUPAC name is methyl 6-methyl-1,6-diazatricyclo[6.2.2.02,7]dodecane-3-carboxylate.
Analyze methyl 6-methyl-1,6-diazatricyclo[6.2.2.02,7]dodecane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-methyl-1,6-diazatricyclo[6.2.2.02,7]dodecane-3-carboxylate?
The IUPAC name of methyl 6-methyl-1,6-diazatricyclo[6.2.2.02,7]dodecane-3-carboxylate (CID 83986224) is methyl 6-methyl-1,6-diazatricyclo[6.2.2.02,7]dodecane-3-carboxylate.
What is the SMILES notation for methyl 6-methyl-1,6-diazatricyclo[6.2.2.02,7]dodecane-3-carboxylate?
The canonical SMILES for methyl 6-methyl-1,6-diazatricyclo[6.2.2.02,7]dodecane-3-carboxylate is COC(=O)C1CCN(C)C2C3CCN(CC3)C12.
What is the InChIKey of methyl 6-methyl-1,6-diazatricyclo[6.2.2.02,7]dodecane-3-carboxylate?
The InChIKey is SRTRSLKTZIWQMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O2/c1-14-6-5-10(13(16)17-2)12-11(14)9-3-7-15(12)8-4-9/h9-12H,3-8H2,1-2H3.
What are the key properties of methyl 6-methyl-1,6-diazatricyclo[6.2.2.02,7]dodecane-3-carboxylate?
methyl 6-methyl-1,6-diazatricyclo[6.2.2.02,7]dodecane-3-carboxylate has a molecular weight of 238.33 g/mol, XLogP of 0.57, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-methyl-1,6-diazatricyclo[6.2.2.02,7]dodecane-3-carboxylate is sourced from PubChem (CID 83986224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).