C13H20F2N2S — CID 83992794
N-(2,2-difluoroethyl)-1-ethyl-5-thiophen-2-ylpiperidin-3-amine (PubChem CID 83992794) has the molecular formula C13H20F2N2S and a molecular weight of 274.38 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-1-ethyl-5-thiophen-2-ylpiperidin-3-amine.
| Compound Name | N-(2,2-difluoroethyl)-1-ethyl-5-thiophen-2-ylpiperidin-3-amine |
|---|---|
| PubChem CID | 83992794 |
| Molecular Formula | C13H20F2N2S |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | N-(2,2-difluoroethyl)-1-ethyl-5-thiophen-2-ylpiperidin-3-amine |
| SMILES | CCN1CC(NCC(F)F)CC(c2cccs2)C1 |
| InChI | InChI=1S/C13H20F2N2S/c1-2-17-8-10(12-4-3-5-18-12)6-11(9-17)16-7-13(14)15/h3-5,10-11,13,16H,2,6-9H2,1H3 |
| InChIKey | JTSQYEVEIYKEEC-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |