C19H30N2S — CID 83998686
N-(cyclohexylmethyl)-1-cyclopropyl-5-thiophen-2-ylpiperidin-3-amine (PubChem CID 83998686) has the molecular formula C19H30N2S and a molecular weight of 318.53 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-1-cyclopropyl-5-thiophen-2-ylpiperidin-3-amine.
| Compound Name | N-(cyclohexylmethyl)-1-cyclopropyl-5-thiophen-2-ylpiperidin-3-amine |
|---|---|
| PubChem CID | 83998686 |
| Molecular Formula | C19H30N2S |
| Molecular Weight | 318.53 g/mol |
| Exact Mass | 318.21 |
| IUPAC Name | N-(cyclohexylmethyl)-1-cyclopropyl-5-thiophen-2-ylpiperidin-3-amine |
| SMILES | c1csc(C2CC(NCC3CCCCC3)CN(C3CC3)C2)c1 |
| InChI | InChI=1S/C19H30N2S/c1-2-5-15(6-3-1)12-20-17-11-16(19-7-4-10-22-19)13-21(14-17)18-8-9-18/h4,7,10,15-18,20H,1-3,5-6,8-9,11-14H2 |
| InChIKey | LWIWTNSSLIRGOW-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.53 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |