C18H26N2O5 — CID 84550395
1-[4-(2,4-dimethoxyphenyl)-4-hydroxybutanoyl]piperidine-4-carboxamide (PubChem CID 84550395) has the molecular formula C18H26N2O5 and a molecular weight of 350.42 g/mol. Its IUPAC name is 1-[4-(2,4-dimethoxyphenyl)-4-hydroxybutanoyl]piperidine-4-carboxamide.
| Compound Name | 1-[4-(2,4-dimethoxyphenyl)-4-hydroxybutanoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 84550395 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | 1-[4-(2,4-dimethoxyphenyl)-4-hydroxybutanoyl]piperidine-4-carboxamide |
| SMILES | COc1ccc(C(O)CCC(=O)N2CCC(C(N)=O)CC2)c(OC)c1 |
| InChI | InChI=1S/C18H26N2O5/c1-24-13-3-4-14(16(11-13)25-2)15(21)5-6-17(22)20-9-7-12(8-10-20)18(19)23/h3-4,11-12,15,21H,5-10H2,1-2H3,(H2,19,23) |
| InChIKey | VMOVDYWNPBMDDL-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |