C12H12N2O2S — CID 84584448
[2-(furan-3-yl)-1,3-thiazol-5-yl]-pyrrolidin-1-ylmethanone (PubChem CID 84584448) has the molecular formula C12H12N2O2S and a molecular weight of 248.31 g/mol. Its IUPAC name is [2-(furan-3-yl)-1,3-thiazol-5-yl]-pyrrolidin-1-ylmethanone.
| Compound Name | [2-(furan-3-yl)-1,3-thiazol-5-yl]-pyrrolidin-1-ylmethanone |
|---|---|
| PubChem CID | 84584448 |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | [2-(furan-3-yl)-1,3-thiazol-5-yl]-pyrrolidin-1-ylmethanone |
| SMILES | O=C(c1cnc(-c2ccoc2)s1)N1CCCC1 |
| InChI | InChI=1S/C12H12N2O2S/c15-12(14-4-1-2-5-14)10-7-13-11(17-10)9-3-6-16-8-9/h3,6-8H,1-2,4-5H2 |
| InChIKey | BMSAWXUZALWAOB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |