C14H19ClN2O2S2 — CID 84585925
2-(5-chlorothiophen-2-yl)-N-(1-oxo-1-thiomorpholin-4-ylpropan-2-yl)propanamide (PubChem CID 84585925) has the molecular formula C14H19ClN2O2S2 and a molecular weight of 346.91 g/mol. Its IUPAC name is 2-(5-chlorothiophen-2-yl)-N-(1-oxo-1-thiomorpholin-4-ylpropan-2-yl)propanamide.
| Compound Name | 2-(5-chlorothiophen-2-yl)-N-(1-oxo-1-thiomorpholin-4-ylpropan-2-yl)propanamide |
|---|---|
| PubChem CID | 84585925 |
| Molecular Formula | C14H19ClN2O2S2 |
| Molecular Weight | 346.91 g/mol |
| Exact Mass | 346.06 |
| IUPAC Name | 2-(5-chlorothiophen-2-yl)-N-(1-oxo-1-thiomorpholin-4-ylpropan-2-yl)propanamide |
| SMILES | CC(NC(=O)C(C)c1ccc(Cl)s1)C(=O)N1CCSCC1 |
| InChI | InChI=1S/C14H19ClN2O2S2/c1-9(11-3-4-12(15)21-11)13(18)16-10(2)14(19)17-5-7-20-8-6-17/h3-4,9-10H,5-8H2,1-2H3,(H,16,18) |
| InChIKey | PQKHMGILUVULQN-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.91 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |