About [3-[(2-Phenyl-1,3-oxazol-4-yl)methylamino]-4-pyridinyl]methanol
[3-[(2-Phenyl-1,3-oxazol-4-yl)methylamino]-4-pyridinyl]methanol (PubChem CID 84595089) has the molecular formula C16H15N3O2
and a molecular weight of 281.31 g/mol. Its IUPAC name is [3-[(2-phenyl-1,3-oxazol-4-yl)methylamino]-4-pyridinyl]methanol.
Molecular Properties
| Compound Name | [3-[(2-Phenyl-1,3-oxazol-4-yl)methylamino]-4-pyridinyl]methanol |
| PubChem CID | 84595089 |
| Molecular Formula | C16H15N3O2 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | [3-[(2-phenyl-1,3-oxazol-4-yl)methylamino]-4-pyridinyl]methanol |
| SMILES | C1=CC=C(C=C1)C2=NC(=CO2)CNC3=C(C=CN=C3)CO |
| InChI | InChI=1S/C16H15N3O2/c20-10-13-6-7-17-9-15(13)18-8-14-11-21-16(19-14)12-4-2-1-3-5-12/h1-7,9,11,18,20H,8,10H2 |
| InChIKey | PPARMRUDQNGOCJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 71.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | 310 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-[(2-Phenyl-1,3-oxazol-4-yl)methylamino]-4-pyridinyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[(2-Phenyl-1,3-oxazol-4-yl)methylamino]-4-pyridinyl]methanol?
The IUPAC name of [3-[(2-Phenyl-1,3-oxazol-4-yl)methylamino]-4-pyridinyl]methanol (CID 84595089) is [3-[(2-phenyl-1,3-oxazol-4-yl)methylamino]-4-pyridinyl]methanol.
What is the SMILES notation for [3-[(2-Phenyl-1,3-oxazol-4-yl)methylamino]-4-pyridinyl]methanol?
The canonical SMILES for [3-[(2-Phenyl-1,3-oxazol-4-yl)methylamino]-4-pyridinyl]methanol is C1=CC=C(C=C1)C2=NC(=CO2)CNC3=C(C=CN=C3)CO.
What is the InChIKey of [3-[(2-Phenyl-1,3-oxazol-4-yl)methylamino]-4-pyridinyl]methanol?
The InChIKey is PPARMRUDQNGOCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3O2/c20-10-13-6-7-17-9-15(13)18-8-14-11-21-16(19-14)12-4-2-1-3-5-12/h1-7,9,11,18,20H,8,10H2.
What are the key properties of [3-[(2-Phenyl-1,3-oxazol-4-yl)methylamino]-4-pyridinyl]methanol?
[3-[(2-Phenyl-1,3-oxazol-4-yl)methylamino]-4-pyridinyl]methanol has a molecular weight of 281.31 g/mol, XLogP of 2.10, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[(2-Phenyl-1,3-oxazol-4-yl)methylamino]-4-pyridinyl]methanol is sourced from PubChem (CID 84595089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).