About propan-2-yl 3-[5-(methoxymethyl)-1,3,4-oxadiazol-2-yl]benzoate
propan-2-yl 3-[5-(methoxymethyl)-1,3,4-oxadiazol-2-yl]benzoate (PubChem CID 84596799) has the molecular formula C14H16N2O4
and a molecular weight of 276.29 g/mol. Its IUPAC name is propan-2-yl 3-[5-(methoxymethyl)-1,3,4-oxadiazol-2-yl]benzoate.
Analyze propan-2-yl 3-[5-(methoxymethyl)-1,3,4-oxadiazol-2-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-yl 3-[5-(methoxymethyl)-1,3,4-oxadiazol-2-yl]benzoate?
The IUPAC name of propan-2-yl 3-[5-(methoxymethyl)-1,3,4-oxadiazol-2-yl]benzoate (CID 84596799) is propan-2-yl 3-[5-(methoxymethyl)-1,3,4-oxadiazol-2-yl]benzoate.
What is the SMILES notation for propan-2-yl 3-[5-(methoxymethyl)-1,3,4-oxadiazol-2-yl]benzoate?
The canonical SMILES for propan-2-yl 3-[5-(methoxymethyl)-1,3,4-oxadiazol-2-yl]benzoate is COCc1nnc(-c2cccc(C(=O)OC(C)C)c2)o1.
What is the InChIKey of propan-2-yl 3-[5-(methoxymethyl)-1,3,4-oxadiazol-2-yl]benzoate?
The InChIKey is HERICRXZBBYKEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N2O4/c1-9(2)19-14(17)11-6-4-5-10(7-11)13-16-15-12(20-13)8-18-3/h4-7,9H,8H2,1-3H3.
What are the key properties of propan-2-yl 3-[5-(methoxymethyl)-1,3,4-oxadiazol-2-yl]benzoate?
propan-2-yl 3-[5-(methoxymethyl)-1,3,4-oxadiazol-2-yl]benzoate has a molecular weight of 276.29 g/mol, XLogP of 2.45, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-yl 3-[5-(methoxymethyl)-1,3,4-oxadiazol-2-yl]benzoate is sourced from PubChem (CID 84596799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).