C15H15BrN2O2 — CID 84610246
6-amino-5-bromo-1-(furan-2-ylmethyl)-3,3-dimethylindol-2-one (PubChem CID 84610246) has the molecular formula C15H15BrN2O2 and a molecular weight of 335.20 g/mol. Its IUPAC name is 6-amino-5-bromo-1-(furan-2-ylmethyl)-3,3-dimethylindol-2-one.
| Compound Name | 6-amino-5-bromo-1-(furan-2-ylmethyl)-3,3-dimethylindol-2-one |
|---|---|
| PubChem CID | 84610246 |
| Molecular Formula | C15H15BrN2O2 |
| Molecular Weight | 335.20 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 6-amino-5-bromo-1-(furan-2-ylmethyl)-3,3-dimethylindol-2-one |
| SMILES | CC1(C)C(=O)N(Cc2ccco2)c2cc(N)c(Br)cc21 |
| InChI | InChI=1S/C15H15BrN2O2/c1-15(2)10-6-11(16)12(17)7-13(10)18(14(15)19)8-9-4-3-5-20-9/h3-7H,8,17H2,1-2H3 |
| InChIKey | UTJLTYOCYKNCBQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 59.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.20 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|