C11H9BrCl2N2O — CID 84610430
5-bromo-4-(2,3-dichloro-4-methoxyphenyl)-2-methyl-1H-imidazole (PubChem CID 84610430) has the molecular formula C11H9BrCl2N2O and a molecular weight of 336.02 g/mol. Its IUPAC name is 5-bromo-4-(2,3-dichloro-4-methoxyphenyl)-2-methyl-1H-imidazole.
| Compound Name | 5-bromo-4-(2,3-dichloro-4-methoxyphenyl)-2-methyl-1H-imidazole |
|---|---|
| PubChem CID | 84610430 |
| Molecular Formula | C11H9BrCl2N2O |
| Molecular Weight | 336.02 g/mol |
| Exact Mass | 333.93 |
| IUPAC Name | 5-bromo-4-(2,3-dichloro-4-methoxyphenyl)-2-methyl-1H-imidazole |
| SMILES | COc1ccc(-c2nc(C)[nH]c2Br)c(Cl)c1Cl |
| InChI | InChI=1S/C11H9BrCl2N2O/c1-5-15-10(11(12)16-5)6-3-4-7(17-2)9(14)8(6)13/h3-4H,1-2H3,(H,15,16) |
| InChIKey | IOSXRRBMPNPICI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.02 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |