C12H15ClN4O2 — CID 63632217
4-(2-chloro-3,4-dimethoxyphenyl)-2-methylimidazole-1,5-diamine (PubChem CID 63632217) has the molecular formula C12H15ClN4O2 and a molecular weight of 282.73 g/mol. Its IUPAC name is 4-(2-chloro-3,4-dimethoxyphenyl)-2-methylimidazole-1,5-diamine.
| Compound Name | 4-(2-chloro-3,4-dimethoxyphenyl)-2-methylimidazole-1,5-diamine |
|---|---|
| PubChem CID | 63632217 |
| Molecular Formula | C12H15ClN4O2 |
| Molecular Weight | 282.73 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 4-(2-chloro-3,4-dimethoxyphenyl)-2-methylimidazole-1,5-diamine |
| SMILES | COc1ccc(-c2nc(C)n(N)c2N)c(Cl)c1OC |
| InChI | InChI=1S/C12H15ClN4O2/c1-6-16-10(12(14)17(6)15)7-4-5-8(18-2)11(19-3)9(7)13/h4-5H,14-15H2,1-3H3 |
| InChIKey | XFEQXEOQVQPPMM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.73 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |