C14H17NO2S — CID 84615087
2-ethyl-4-methyl-6-propanoyl-1,4-benzothiazin-3-one (PubChem CID 84615087) has the molecular formula C14H17NO2S and a molecular weight of 263.36 g/mol. Its IUPAC name is 2-ethyl-4-methyl-6-propanoyl-1,4-benzothiazin-3-one.
| Compound Name | 2-ethyl-4-methyl-6-propanoyl-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 84615087 |
| Molecular Formula | C14H17NO2S |
| Molecular Weight | 263.36 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 2-ethyl-4-methyl-6-propanoyl-1,4-benzothiazin-3-one |
| SMILES | CCC(=O)c1ccc2c(c1)N(C)C(=O)C(CC)S2 |
| InChI | InChI=1S/C14H17NO2S/c1-4-11(16)9-6-7-13-10(8-9)15(3)14(17)12(5-2)18-13/h6-8,12H,4-5H2,1-3H3 |
| InChIKey | PBHNXPDVCCSFGM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |