C16H19NO2S — CID 84615176
7-acetyl-4-but-3-enyl-2-ethyl-1,4-benzothiazin-3-one (PubChem CID 84615176) has the molecular formula C16H19NO2S and a molecular weight of 289.40 g/mol. Its IUPAC name is 7-acetyl-4-but-3-enyl-2-ethyl-1,4-benzothiazin-3-one.
| Compound Name | 7-acetyl-4-but-3-enyl-2-ethyl-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 84615176 |
| Molecular Formula | C16H19NO2S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 7-acetyl-4-but-3-enyl-2-ethyl-1,4-benzothiazin-3-one |
| SMILES | C=CCCN1C(=O)C(CC)Sc2cc(C(C)=O)ccc21 |
| InChI | InChI=1S/C16H19NO2S/c1-4-6-9-17-13-8-7-12(11(3)18)10-15(13)20-14(5-2)16(17)19/h4,7-8,10,14H,1,5-6,9H2,2-3H3 |
| InChIKey | FZOPOMQJKIGZNS-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|