C14H15NO3S — CID 84615776
7-acetyl-2-methyl-1-oxo-4-prop-2-enyl-1λ4,4-benzothiazin-3-one (PubChem CID 84615776) has the molecular formula C14H15NO3S and a molecular weight of 277.35 g/mol. Its IUPAC name is 7-acetyl-2-methyl-1-oxo-4-prop-2-enyl-1λ4,4-benzothiazin-3-one.
| Compound Name | 7-acetyl-2-methyl-1-oxo-4-prop-2-enyl-1λ4,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 84615776 |
| Molecular Formula | C14H15NO3S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | 7-acetyl-2-methyl-1-oxo-4-prop-2-enyl-1λ4,4-benzothiazin-3-one |
| SMILES | C=CCN1C(=O)C(C)S(=O)c2cc(C(C)=O)ccc21 |
| InChI | InChI=1S/C14H15NO3S/c1-4-7-15-12-6-5-11(9(2)16)8-13(12)19(18)10(3)14(15)17/h4-6,8,10H,1,7H2,2-3H3 |
| InChIKey | BSSVFLXXSLJAFG-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|