C13H13NO2S — CID 84616022
2-methyl-3-oxo-4-prop-2-enyl-1,4-benzothiazine-7-carbaldehyde (PubChem CID 84616022) has the molecular formula C13H13NO2S and a molecular weight of 247.32 g/mol. Its IUPAC name is 2-methyl-3-oxo-4-prop-2-enyl-1,4-benzothiazine-7-carbaldehyde.
| Compound Name | 2-methyl-3-oxo-4-prop-2-enyl-1,4-benzothiazine-7-carbaldehyde |
|---|---|
| PubChem CID | 84616022 |
| Molecular Formula | C13H13NO2S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | 2-methyl-3-oxo-4-prop-2-enyl-1,4-benzothiazine-7-carbaldehyde |
| SMILES | C=CCN1C(=O)C(C)Sc2cc(C=O)ccc21 |
| InChI | InChI=1S/C13H13NO2S/c1-3-6-14-11-5-4-10(8-15)7-12(11)17-9(2)13(14)16/h3-5,7-9H,1,6H2,2H3 |
| InChIKey | TTXAHUFTDYHEMI-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|