C15H17NO3S — CID 84615814
7-acetyl-4-cyclopentyl-1-oxo-1λ4,4-benzothiazin-3-one (PubChem CID 84615814) has the molecular formula C15H17NO3S and a molecular weight of 291.37 g/mol. Its IUPAC name is 7-acetyl-4-cyclopentyl-1-oxo-1λ4,4-benzothiazin-3-one.
| Compound Name | 7-acetyl-4-cyclopentyl-1-oxo-1λ4,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 84615814 |
| Molecular Formula | C15H17NO3S |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | 7-acetyl-4-cyclopentyl-1-oxo-1λ4,4-benzothiazin-3-one |
| SMILES | CC(=O)c1ccc2c(c1)S(=O)CC(=O)N2C1CCCC1 |
| InChI | InChI=1S/C15H17NO3S/c1-10(17)11-6-7-13-14(8-11)20(19)9-15(18)16(13)12-4-2-3-5-12/h6-8,12H,2-5,9H2,1H3 |
| InChIKey | NUNHCADTMKIHEU-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |