C13H17N3O2S — CID 84615505
2-(7-amino-2,2-dimethyl-3-oxo-1,4-benzothiazin-4-yl)-N-methylacetamide (PubChem CID 84615505) has the molecular formula C13H17N3O2S and a molecular weight of 279.37 g/mol. Its IUPAC name is 2-(7-amino-2,2-dimethyl-3-oxo-1,4-benzothiazin-4-yl)-N-methylacetamide.
| Compound Name | 2-(7-amino-2,2-dimethyl-3-oxo-1,4-benzothiazin-4-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 84615505 |
| Molecular Formula | C13H17N3O2S |
| Molecular Weight | 279.37 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | 2-(7-amino-2,2-dimethyl-3-oxo-1,4-benzothiazin-4-yl)-N-methylacetamide |
| SMILES | CNC(=O)CN1C(=O)C(C)(C)Sc2cc(N)ccc21 |
| InChI | InChI=1S/C13H17N3O2S/c1-13(2)12(18)16(7-11(17)15-3)9-5-4-8(14)6-10(9)19-13/h4-6H,7,14H2,1-3H3,(H,15,17) |
| InChIKey | NXNHLQDWMRARNN-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.37 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|