C13H16N2O3S — CID 84615491
2-(7-amino-2,2-dimethyl-3-oxo-1,4-benzothiazin-4-yl)propanoic acid (PubChem CID 84615491) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is 2-(7-amino-2,2-dimethyl-3-oxo-1,4-benzothiazin-4-yl)propanoic acid.
| Compound Name | 2-(7-amino-2,2-dimethyl-3-oxo-1,4-benzothiazin-4-yl)propanoic acid |
|---|---|
| PubChem CID | 84615491 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 2-(7-amino-2,2-dimethyl-3-oxo-1,4-benzothiazin-4-yl)propanoic acid |
| SMILES | CC(C(=O)O)N1C(=O)C(C)(C)Sc2cc(N)ccc21 |
| InChI | InChI=1S/C13H16N2O3S/c1-7(11(16)17)15-9-5-4-8(14)6-10(9)19-13(2,3)12(15)18/h4-7H,14H2,1-3H3,(H,16,17) |
| InChIKey | UDLXPIVCENNKAJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|