C8H9ClN4 — CID 84619445
5-chloro-4-methylbenzimidazole-1,2-diamine (PubChem CID 84619445) has the molecular formula C8H9ClN4 and a molecular weight of 196.64 g/mol. Its IUPAC name is 5-chloro-4-methylbenzimidazole-1,2-diamine.
| Compound Name | 5-chloro-4-methylbenzimidazole-1,2-diamine |
|---|---|
| PubChem CID | 84619445 |
| Molecular Formula | C8H9ClN4 |
| Molecular Weight | 196.64 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | 5-chloro-4-methylbenzimidazole-1,2-diamine |
| SMILES | Cc1c(Cl)ccc2c1nc(N)n2N |
| InChI | InChI=1S/C8H9ClN4/c1-4-5(9)2-3-6-7(4)12-8(10)13(6)11/h2-3H,11H2,1H3,(H2,10,12) |
| InChIKey | YPGJFIYZCPVPJE-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.64 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |