C12H16FNO — CID 84621243
2-tert-butyl-5-fluoro-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 84621243) has the molecular formula C12H16FNO and a molecular weight of 209.26 g/mol. Its IUPAC name is 2-tert-butyl-5-fluoro-3,4-dihydro-2H-1,4-benzoxazine.
| Compound Name | 2-tert-butyl-5-fluoro-3,4-dihydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 84621243 |
| Molecular Formula | C12H16FNO |
| Molecular Weight | 209.26 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 2-tert-butyl-5-fluoro-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | CC(C)(C)C1CNc2c(F)cccc2O1 |
| InChI | InChI=1S/C12H16FNO/c1-12(2,3)10-7-14-11-8(13)5-4-6-9(11)15-10/h4-6,10,14H,7H2,1-3H3 |
| InChIKey | XONZBNZQTZZCOZ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.26 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |