C10H12ClNOS — CID 84625965
2-(6-chloro-3,4-dihydro-2H-1,4-benzothiazin-3-yl)ethanol (PubChem CID 84625965) has the molecular formula C10H12ClNOS and a molecular weight of 229.73 g/mol. Its IUPAC name is 2-(6-chloro-3,4-dihydro-2H-1,4-benzothiazin-3-yl)ethanol.
| Compound Name | 2-(6-chloro-3,4-dihydro-2H-1,4-benzothiazin-3-yl)ethanol |
|---|---|
| PubChem CID | 84625965 |
| Molecular Formula | C10H12ClNOS |
| Molecular Weight | 229.73 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | 2-(6-chloro-3,4-dihydro-2H-1,4-benzothiazin-3-yl)ethanol |
| SMILES | OCCC1CSc2ccc(Cl)cc2N1 |
| InChI | InChI=1S/C10H12ClNOS/c11-7-1-2-10-9(5-7)12-8(3-4-13)6-14-10/h1-2,5,8,12-13H,3-4,6H2 |
| InChIKey | FKUBUKKFJQUQHT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.73 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |