C8H6ClNS2 — CID 11424466
6-chloro-4H-1,4-benzothiazine-3-thione (PubChem CID 11424466) has the molecular formula C8H6ClNS2 and a molecular weight of 215.73 g/mol. Its IUPAC name is 6-chloro-4H-1,4-benzothiazine-3-thione.
| Compound Name | 6-chloro-4H-1,4-benzothiazine-3-thione |
|---|---|
| PubChem CID | 11424466 |
| Molecular Formula | C8H6ClNS2 |
| Molecular Weight | 215.73 g/mol |
| Exact Mass | 214.96 |
| IUPAC Name | 6-chloro-4H-1,4-benzothiazine-3-thione |
| SMILES | S=C1CSc2ccc(Cl)cc2N1 |
| InChI | InChI=1S/C8H6ClNS2/c9-5-1-2-7-6(3-5)10-8(11)4-12-7/h1-3H,4H2,(H,10,11) |
| InChIKey | PDUWOKBEOQKNPI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.73 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|