About 4-methyl-3-[2-(methylamino)ethyl]-2,3-dihydro-1,4-benzoxazine-8-carbonitrile
4-methyl-3-[2-(methylamino)ethyl]-2,3-dihydro-1,4-benzoxazine-8-carbonitrile (PubChem CID 84626628) has the molecular formula C13H17N3O
and a molecular weight of 231.30 g/mol. Its IUPAC name is 4-methyl-3-[2-(methylamino)ethyl]-2,3-dihydro-1,4-benzoxazine-8-carbonitrile.
Molecular Properties
| Compound Name | 4-methyl-3-[2-(methylamino)ethyl]-2,3-dihydro-1,4-benzoxazine-8-carbonitrile |
| PubChem CID | 84626628 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 4-methyl-3-[2-(methylamino)ethyl]-2,3-dihydro-1,4-benzoxazine-8-carbonitrile |
| SMILES | CNCCC1COc2c(C#N)cccc2N1C |
| InChI | InChI=1S/C13H17N3O/c1-15-7-6-11-9-17-13-10(8-14)4-3-5-12(13)16(11)2/h3-5,11,15H,6-7,9H2,1-2H3 |
| InChIKey | RWTXTDAQMQOQAU-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 48.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methyl-3-[2-(methylamino)ethyl]-2,3-dihydro-1,4-benzoxazine-8-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3-[2-(methylamino)ethyl]-2,3-dihydro-1,4-benzoxazine-8-carbonitrile?
The IUPAC name of 4-methyl-3-[2-(methylamino)ethyl]-2,3-dihydro-1,4-benzoxazine-8-carbonitrile (CID 84626628) is 4-methyl-3-[2-(methylamino)ethyl]-2,3-dihydro-1,4-benzoxazine-8-carbonitrile.
What is the SMILES notation for 4-methyl-3-[2-(methylamino)ethyl]-2,3-dihydro-1,4-benzoxazine-8-carbonitrile?
The canonical SMILES for 4-methyl-3-[2-(methylamino)ethyl]-2,3-dihydro-1,4-benzoxazine-8-carbonitrile is CNCCC1COc2c(C#N)cccc2N1C.
What is the InChIKey of 4-methyl-3-[2-(methylamino)ethyl]-2,3-dihydro-1,4-benzoxazine-8-carbonitrile?
The InChIKey is RWTXTDAQMQOQAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O/c1-15-7-6-11-9-17-13-10(8-14)4-3-5-12(13)16(11)2/h3-5,11,15H,6-7,9H2,1-2H3.
What are the key properties of 4-methyl-3-[2-(methylamino)ethyl]-2,3-dihydro-1,4-benzoxazine-8-carbonitrile?
4-methyl-3-[2-(methylamino)ethyl]-2,3-dihydro-1,4-benzoxazine-8-carbonitrile has a molecular weight of 231.30 g/mol, XLogP of 1.36, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-[2-(methylamino)ethyl]-2,3-dihydro-1,4-benzoxazine-8-carbonitrile is sourced from PubChem (CID 84626628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).