C14H19N3O — CID 84631965
4-methyl-3-[3-(methylamino)propyl]-2,3-dihydro-1,4-benzoxazine-8-carbonitrile (PubChem CID 84631965) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is 4-methyl-3-[3-(methylamino)propyl]-2,3-dihydro-1,4-benzoxazine-8-carbonitrile.
| Compound Name | 4-methyl-3-[3-(methylamino)propyl]-2,3-dihydro-1,4-benzoxazine-8-carbonitrile |
|---|---|
| PubChem CID | 84631965 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 4-methyl-3-[3-(methylamino)propyl]-2,3-dihydro-1,4-benzoxazine-8-carbonitrile |
| SMILES | CNCCCC1COc2c(C#N)cccc2N1C |
| InChI | InChI=1S/C14H19N3O/c1-16-8-4-6-12-10-18-14-11(9-15)5-3-7-13(14)17(12)2/h3,5,7,12,16H,4,6,8,10H2,1-2H3 |
| InChIKey | XYDOBQNYDWGVHX-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 48.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|