C11H10N2O2S — CID 84627750
2-(7-methoxy-3-oxo-4H-1,4-benzothiazin-2-yl)acetonitrile (PubChem CID 84627750) has the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. Its IUPAC name is 2-(7-methoxy-3-oxo-4H-1,4-benzothiazin-2-yl)acetonitrile.
| Compound Name | 2-(7-methoxy-3-oxo-4H-1,4-benzothiazin-2-yl)acetonitrile |
|---|---|
| PubChem CID | 84627750 |
| Molecular Formula | C11H10N2O2S |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.05 |
| IUPAC Name | 2-(7-methoxy-3-oxo-4H-1,4-benzothiazin-2-yl)acetonitrile |
| SMILES | COc1ccc2c(c1)SC(CC#N)C(=O)N2 |
| InChI | InChI=1S/C11H10N2O2S/c1-15-7-2-3-8-10(6-7)16-9(4-5-12)11(14)13-8/h2-3,6,9H,4H2,1H3,(H,13,14) |
| InChIKey | NZJGWUHKMMBLCK-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |