C10H7FN2OS — CID 84624047
2-(7-fluoro-3-oxo-4H-1,4-benzothiazin-2-yl)acetonitrile (PubChem CID 84624047) has the molecular formula C10H7FN2OS and a molecular weight of 222.24 g/mol. Its IUPAC name is 2-(7-fluoro-3-oxo-4H-1,4-benzothiazin-2-yl)acetonitrile.
| Compound Name | 2-(7-fluoro-3-oxo-4H-1,4-benzothiazin-2-yl)acetonitrile |
|---|---|
| PubChem CID | 84624047 |
| Molecular Formula | C10H7FN2OS |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | 2-(7-fluoro-3-oxo-4H-1,4-benzothiazin-2-yl)acetonitrile |
| SMILES | N#CCC1Sc2cc(F)ccc2NC1=O |
| InChI | InChI=1S/C10H7FN2OS/c11-6-1-2-7-9(5-6)15-8(3-4-12)10(14)13-7/h1-2,5,8H,3H2,(H,13,14) |
| InChIKey | OVPHOBCSPKDSHR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |