C11H13FN2OS — CID 84629701
6-fluoro-2-[2-(methylamino)ethyl]-4H-1,4-benzothiazin-3-one (PubChem CID 84629701) has the molecular formula C11H13FN2OS and a molecular weight of 240.30 g/mol. Its IUPAC name is 6-fluoro-2-[2-(methylamino)ethyl]-4H-1,4-benzothiazin-3-one.
| Compound Name | 6-fluoro-2-[2-(methylamino)ethyl]-4H-1,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 84629701 |
| Molecular Formula | C11H13FN2OS |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 6-fluoro-2-[2-(methylamino)ethyl]-4H-1,4-benzothiazin-3-one |
| SMILES | CNCCC1Sc2ccc(F)cc2NC1=O |
| InChI | InChI=1S/C11H13FN2OS/c1-13-5-4-10-11(15)14-8-6-7(12)2-3-9(8)16-10/h2-3,6,10,13H,4-5H2,1H3,(H,14,15) |
| InChIKey | JJVKNTLMZALDKP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |