C11H10N2O3S — CID 84633713
2,2-dioxo-3,3a,9,9a-tetrahydro-1H-thieno[3,4-b][1,4]benzoxazine-7-carbonitrile (PubChem CID 84633713) has the molecular formula C11H10N2O3S and a molecular weight of 250.28 g/mol. Its IUPAC name is 2,2-dioxo-3,3a,9,9a-tetrahydro-1H-thieno[3,4-b][1,4]benzoxazine-7-carbonitrile.
| Compound Name | 2,2-dioxo-3,3a,9,9a-tetrahydro-1H-thieno[3,4-b][1,4]benzoxazine-7-carbonitrile |
|---|---|
| PubChem CID | 84633713 |
| Molecular Formula | C11H10N2O3S |
| Molecular Weight | 250.28 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | 2,2-dioxo-3,3a,9,9a-tetrahydro-1H-thieno[3,4-b][1,4]benzoxazine-7-carbonitrile |
| SMILES | N#Cc1ccc2c(c1)NC1CS(=O)(=O)CC1O2 |
| InChI | InChI=1S/C11H10N2O3S/c12-4-7-1-2-10-8(3-7)13-9-5-17(14,15)6-11(9)16-10/h1-3,9,11,13H,5-6H2 |
| InChIKey | DIHBQBFTUZWCAB-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.28 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |