C10H10ClNO3S — CID 84637977
6-chloro-2,2-dimethyl-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one (PubChem CID 84637977) has the molecular formula C10H10ClNO3S and a molecular weight of 259.71 g/mol. Its IUPAC name is 6-chloro-2,2-dimethyl-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one.
| Compound Name | 6-chloro-2,2-dimethyl-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one |
|---|---|
| PubChem CID | 84637977 |
| Molecular Formula | C10H10ClNO3S |
| Molecular Weight | 259.71 g/mol |
| Exact Mass | 259.01 |
| IUPAC Name | 6-chloro-2,2-dimethyl-1,1-dioxo-4H-1λ6,4-benzothiazin-3-one |
| SMILES | CC1(C)C(=O)Nc2cc(Cl)ccc2S1(=O)=O |
| InChI | InChI=1S/C10H10ClNO3S/c1-10(2)9(13)12-7-5-6(11)3-4-8(7)16(10,14)15/h3-5H,1-2H3,(H,12,13) |
| InChIKey | QNEBODLUSIUPPL-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.71 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |