C15H20N2O2 — CID 84638179
7-methoxy-6,10-dimethyl-1,2,3,4,4a,10b-hexahydrobenzo[c][2,7]naphthyridin-5-one (PubChem CID 84638179) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is 7-methoxy-6,10-dimethyl-1,2,3,4,4a,10b-hexahydrobenzo[c][2,7]naphthyridin-5-one.
| Compound Name | 7-methoxy-6,10-dimethyl-1,2,3,4,4a,10b-hexahydrobenzo[c][2,7]naphthyridin-5-one |
|---|---|
| PubChem CID | 84638179 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 7-methoxy-6,10-dimethyl-1,2,3,4,4a,10b-hexahydrobenzo[c][2,7]naphthyridin-5-one |
| SMILES | COc1ccc(C)c2c1N(C)C(=O)C1CNCCC21 |
| InChI | InChI=1S/C15H20N2O2/c1-9-4-5-12(19-3)14-13(9)10-6-7-16-8-11(10)15(18)17(14)2/h4-5,10-11,16H,6-8H2,1-3H3 |
| InChIKey | NYJXISJIAUFXMI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |