C14H18N2O3 — CID 84638814
8,10-dimethoxy-2,3,4,4a,6,10b-hexahydro-1H-benzo[c][2,6]naphthyridin-5-one (PubChem CID 84638814) has the molecular formula C14H18N2O3 and a molecular weight of 262.31 g/mol. Its IUPAC name is 8,10-dimethoxy-2,3,4,4a,6,10b-hexahydro-1H-benzo[c][2,6]naphthyridin-5-one.
| Compound Name | 8,10-dimethoxy-2,3,4,4a,6,10b-hexahydro-1H-benzo[c][2,6]naphthyridin-5-one |
|---|---|
| PubChem CID | 84638814 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 8,10-dimethoxy-2,3,4,4a,6,10b-hexahydro-1H-benzo[c][2,6]naphthyridin-5-one |
| SMILES | COc1cc2c(c(OC)c1)C1CNCCC1C(=O)N2 |
| InChI | InChI=1S/C14H18N2O3/c1-18-8-5-11-13(12(6-8)19-2)10-7-15-4-3-9(10)14(17)16-11/h5-6,9-10,15H,3-4,7H2,1-2H3,(H,16,17) |
| InChIKey | CBEMSRCZKPHRAJ-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |