C14H14F3NO2 — CID 84643491
2-[1,5,7-trimethyl-2-(trifluoromethyl)indol-3-yl]acetic acid (PubChem CID 84643491) has the molecular formula C14H14F3NO2 and a molecular weight of 285.26 g/mol. Its IUPAC name is 2-[1,5,7-trimethyl-2-(trifluoromethyl)indol-3-yl]acetic acid.
| Compound Name | 2-[1,5,7-trimethyl-2-(trifluoromethyl)indol-3-yl]acetic acid |
|---|---|
| PubChem CID | 84643491 |
| Molecular Formula | C14H14F3NO2 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 2-[1,5,7-trimethyl-2-(trifluoromethyl)indol-3-yl]acetic acid |
| SMILES | Cc1cc(C)c2c(c1)c(CC(=O)O)c(C(F)(F)F)n2C |
| InChI | InChI=1S/C14H14F3NO2/c1-7-4-8(2)12-9(5-7)10(6-11(19)20)13(18(12)3)14(15,16)17/h4-5H,6H2,1-3H3,(H,19,20) |
| InChIKey | DJWCWQPYEOLFAK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |