C14H17BrN2 — CID 84643930
N-[(3-bromo-1,5-dimethylindol-2-yl)methyl]cyclopropanamine (PubChem CID 84643930) has the molecular formula C14H17BrN2 and a molecular weight of 293.21 g/mol. Its IUPAC name is N-[(3-bromo-1,5-dimethylindol-2-yl)methyl]cyclopropanamine.
| Compound Name | N-[(3-bromo-1,5-dimethylindol-2-yl)methyl]cyclopropanamine |
|---|---|
| PubChem CID | 84643930 |
| Molecular Formula | C14H17BrN2 |
| Molecular Weight | 293.21 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | N-[(3-bromo-1,5-dimethylindol-2-yl)methyl]cyclopropanamine |
| SMILES | Cc1ccc2c(c1)c(Br)c(CNC1CC1)n2C |
| InChI | InChI=1S/C14H17BrN2/c1-9-3-6-12-11(7-9)14(15)13(17(12)2)8-16-10-4-5-10/h3,6-7,10,16H,4-5,8H2,1-2H3 |
| InChIKey | RCFAUKNFAHBPHC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.21 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |