C12H14BrN — CID 84707620
3-bromo-2-ethyl-1,6-dimethylindole (PubChem CID 84707620) has the molecular formula C12H14BrN and a molecular weight of 252.15 g/mol. Its IUPAC name is 3-bromo-2-ethyl-1,6-dimethylindole.
| Compound Name | 3-bromo-2-ethyl-1,6-dimethylindole |
|---|---|
| PubChem CID | 84707620 |
| Molecular Formula | C12H14BrN |
| Molecular Weight | 252.15 g/mol |
| Exact Mass | 251.03 |
| IUPAC Name | 3-bromo-2-ethyl-1,6-dimethylindole |
| SMILES | CCc1c(Br)c2ccc(C)cc2n1C |
| InChI | InChI=1S/C12H14BrN/c1-4-10-12(13)9-6-5-8(2)7-11(9)14(10)3/h5-7H,4H2,1-3H3 |
| InChIKey | BYQZTZVRXDBUDU-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.15 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |