C11H15NO3 — CID 8465
1-(3,4-dihydroxyphenyl)-2-(propan-2-ylamino)ethanone (PubChem CID 8465) has the molecular formula C11H15NO3 and a molecular weight of 209.25 g/mol. Its IUPAC name is 1-(3,4-dihydroxyphenyl)-2-(propan-2-ylamino)ethanone.
| Compound Name | 1-(3,4-dihydroxyphenyl)-2-(propan-2-ylamino)ethanone |
|---|---|
| PubChem CID | 8465 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 1-(3,4-dihydroxyphenyl)-2-(propan-2-ylamino)ethanone |
| SMILES | CC(C)NCC(=O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C11H15NO3/c1-7(2)12-6-11(15)8-3-4-9(13)10(14)5-8/h3-5,7,12-14H,6H2,1-2H3 |
| InChIKey | BIQMIYWSZZTXEX-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|