C17H22N2O3 — CID 846530
1-[(3R,3aS)-3-(4-methoxyphenyl)-6,6-dimethyl-3,3a,4,7-tetrahydropyrano[4,3-c]pyrazol-2-yl]ethanone (PubChem CID 846530) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is 1-[(3R,3aS)-3-(4-methoxyphenyl)-6,6-dimethyl-3,3a,4,7-tetrahydropyrano[4,3-c]pyrazol-2-yl]ethanone.
| Compound Name | 1-[(3R,3aS)-3-(4-methoxyphenyl)-6,6-dimethyl-3,3a,4,7-tetrahydropyrano[4,3-c]pyrazol-2-yl]ethanone |
|---|---|
| PubChem CID | 846530 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 1-[(3R,3aS)-3-(4-methoxyphenyl)-6,6-dimethyl-3,3a,4,7-tetrahydropyrano[4,3-c]pyrazol-2-yl]ethanone |
| SMILES | COc1ccc([C@H]2[C@@H]3COC(C)(C)CC3=NN2C(C)=O)cc1 |
| InChI | InChI=1S/C17H22N2O3/c1-11(20)19-16(12-5-7-13(21-4)8-6-12)14-10-22-17(2,3)9-15(14)18-19/h5-8,14,16H,9-10H2,1-4H3/t14-,16+/m1/s1 |
| InChIKey | DEYWYIBQEVBCGD-ZBFHGGJFSA-N |
| XLogP | 2.77 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |