C8H8ClNO — CID 84653626
4-chloro-2,3-dihydro-1H-indol-7-ol (PubChem CID 84653626) has the molecular formula C8H8ClNO and a molecular weight of 169.61 g/mol. Its IUPAC name is 4-chloro-2,3-dihydro-1H-indol-7-ol.
| Compound Name | 4-chloro-2,3-dihydro-1H-indol-7-ol |
|---|---|
| PubChem CID | 84653626 |
| Molecular Formula | C8H8ClNO |
| Molecular Weight | 169.61 g/mol |
| Exact Mass | 169.03 |
| IUPAC Name | 4-chloro-2,3-dihydro-1H-indol-7-ol |
| SMILES | Oc1ccc(Cl)c2c1NCC2 |
| InChI | InChI=1S/C8H8ClNO/c9-6-1-2-7(11)8-5(6)3-4-10-8/h1-2,10-11H,3-4H2 |
| InChIKey | JXQMPZADWVVJOE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.61 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|