About 2-(5-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid
2-(5-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid (PubChem CID 84654082) has the molecular formula C8H13NO3
and a molecular weight of 171.20 g/mol. Its IUPAC name is 2-(5-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid.
Analyze 2-(5-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid?
The IUPAC name of 2-(5-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid (CID 84654082) is 2-(5-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid.
What is the SMILES notation for 2-(5-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid?
The canonical SMILES for 2-(5-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid is CC(C)C1CN=C(CC(=O)O)O1.
What is the InChIKey of 2-(5-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid?
The InChIKey is RRIRDQCCCFSLNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13NO3/c1-5(2)6-4-9-7(12-6)3-8(10)11/h5-6H,3-4H2,1-2H3,(H,10,11).
What are the key properties of 2-(5-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid?
2-(5-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid has a molecular weight of 171.20 g/mol, XLogP of 0.91, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-propan-2-yl-4,5-dihydro-1,3-oxazol-2-yl)acetic acid is sourced from PubChem (CID 84654082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).