About 2-[1-(3,3-difluoropropyl)azetidin-2-yl]acetonitrile
2-[1-(3,3-difluoropropyl)azetidin-2-yl]acetonitrile (PubChem CID 84654855) has the molecular formula C8H12F2N2
and a molecular weight of 174.19 g/mol. Its IUPAC name is 2-[1-(3,3-difluoropropyl)azetidin-2-yl]acetonitrile.
Analyze 2-[1-(3,3-difluoropropyl)azetidin-2-yl]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(3,3-difluoropropyl)azetidin-2-yl]acetonitrile?
The IUPAC name of 2-[1-(3,3-difluoropropyl)azetidin-2-yl]acetonitrile (CID 84654855) is 2-[1-(3,3-difluoropropyl)azetidin-2-yl]acetonitrile.
What is the SMILES notation for 2-[1-(3,3-difluoropropyl)azetidin-2-yl]acetonitrile?
The canonical SMILES for 2-[1-(3,3-difluoropropyl)azetidin-2-yl]acetonitrile is N#CCC1CCN1CCC(F)F.
What is the InChIKey of 2-[1-(3,3-difluoropropyl)azetidin-2-yl]acetonitrile?
The InChIKey is QPYVPQLVBXEDMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F2N2/c9-8(10)3-6-12-5-2-7(12)1-4-11/h7-8H,1-3,5-6H2.
What are the key properties of 2-[1-(3,3-difluoropropyl)azetidin-2-yl]acetonitrile?
2-[1-(3,3-difluoropropyl)azetidin-2-yl]acetonitrile has a molecular weight of 174.19 g/mol, XLogP of 1.63, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(3,3-difluoropropyl)azetidin-2-yl]acetonitrile is sourced from PubChem (CID 84654855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).